Compound Q&A

What industries use 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

Answer

2-Fluoro-5-Nitrobenzonitrile
2-Fluoro-5-Nitrobenzonitrile is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring fluorine-containing functional groups. It is also utilized in the production of dyes and pigments. Additionally, it finds applications in the preparation of materials for sensors and semiconductors due to its chemical properties.

About

CAS No 17417-09-3
English Name 2-Fluoro-5-Nitrobenzonitrile
Molecular Formula C7H3FN2O2
Molecular Weight 166.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C#N)F
InChIKey YLACBMHBZVYOAP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

2-Fluoro-5-Nitrobenzonitrile is a crystalline solid with a molecular weight of approximately 214.05 ...

Compound Q&A

How is 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3) typically synthesized?

2-Fluoro-5-Nitrobenzonitrile can be synthesized through the nitration of 2-fluorobenzonitrile follow...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

Handling 2-Fluoro-5-Nitrobenzonitrile requires strict safety measures. It should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...