Compound Q&A

How is 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3) typically synthesized?

Answer

2-Fluoro-5-Nitrobenzonitrile
2-Fluoro-5-Nitrobenzonitrile can be synthesized through the nitration of 2-fluorobenzonitrile followed by a selective reduction of the nitro group. This typically involves the use of concentrated nitric acid and sulfuric acid as the nitrating agent, with controlled conditions to achieve the desired product. The reaction is monitored to ensure selectivity and yield.

About

CAS No 17417-09-3
English Name 2-Fluoro-5-Nitrobenzonitrile
Molecular Formula C7H3FN2O2
Molecular Weight 166.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C#N)F
InChIKey YLACBMHBZVYOAP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

2-Fluoro-5-Nitrobenzonitrile is a crystalline solid with a molecular weight of approximately 214.05 ...

Compound Q&A

What industries use 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

2-Fluoro-5-Nitrobenzonitrile is used in the pharmaceutical industry for the synthesis of certain dru...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-Nitrobenzonitrile (CAS: 17417-09-3)?

Handling 2-Fluoro-5-Nitrobenzonitrile requires strict safety measures. It should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...