Compound Q&A

What industries use 4-Azidophenylalanine (CAS: 33173-53-4)?

Answer

4-Azidophenylalanine
4-Azidophenylalanine is used in various industries, including pharmaceuticals for drug development, where it serves as a building block for synthetic peptides. It is also used in polymer synthesis for creating functional materials, and in the development of sensors and semiconductors for electronic devices.

About

CAS No 33173-53-4
English Name 4-Azidophenylalanine
Molecular Formula C9H10N4O2
Molecular Weight 206.2 g/mol
SMILES c1cc(ccc1C[C@@H](C(=O)O)N)[N-][N+]#N
InChIKey NEMHIKRLROONTL-QMMMGPOBSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Azidophenylalanine (CAS: 33173-53-4)?

4-Azidophenylalanine is a crystalline compound with a molecular weight of approximately 252.11 g/mol...

Compound Q&A

How is 4-Azidophenylalanine (CAS: 33173-53-4) typically synthesized?

4-Azidophenylalanine is typically synthesized by protecting the phenylalanine amine group, then intr...

Compound Q&A

What precautions should be taken when handling 4-Azidophenylalanine (CAS: 33173-53-4)?

When handling 4-Azidophenylalanine, ensure to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...