Compound Q&A

What precautions should be taken when handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

Answer

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
When handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize exposure to the air. In case of a spill, immediate cleaning with water and appropriate absorbent materials should be performed. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 330-14-3
English Name 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
Molecular Formula C8H4ClF3OS
Molecular Weight 240.63 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)SC(F)(F)F
InChIKey BCMFTOCCLOAGBP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is a solid at room temperature with a ...

Compound Q&A

How is 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) typically synthesized?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) can be synthesized through a multi-ste...

Compound Q&A

What industries use 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is primarily used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...