Compound Q&A

What are the physical and chemical properties of 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

Answer

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is a solid at room temperature with a crystalline form. Its molecular weight is approximately 326.02 g/mol. It is practically insoluble in water but soluble in organic solvents like dichloromethane and acetonitrile. This compound is highly reactive and can undergo nucleophilic substitution reactions, making it a useful reagent in organic synthesis.

About

CAS No 330-14-3
English Name 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
Molecular Formula C8H4ClF3OS
Molecular Weight 240.63 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)SC(F)(F)F
InChIKey BCMFTOCCLOAGBP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) typically synthesized?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) can be synthesized through a multi-ste...

Compound Q&A

What industries use 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

When handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3), it is crucial to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...