Compound Q&A

What industries use 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

Answer

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is primarily used in the pharmaceuticals and polymer industries. It serves as a key intermediate in the synthesis of various drug candidates and polymers with specific chemical properties. Additionally, it may have applications in the sensor and semiconductor industries due to its unique chemical reactivity and stability.

About

CAS No 330-14-3
English Name 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride
Molecular Formula C8H4ClF3OS
Molecular Weight 240.63 g/mol
SMILES C1=CC(=CC=C1C(=O)Cl)SC(F)(F)F
InChIKey BCMFTOCCLOAGBP-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) is a solid at room temperature with a ...

Compound Q&A

How is 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) typically synthesized?

4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3) can be synthesized through a multi-ste...

Compound Q&A

What precautions should be taken when handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3)?

When handling 4-[(Trifluoromethyl)sulfanyl]benzoyl chloride (CAS: 330-14-3), it is crucial to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...