Compound Q&A

What industries use 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

Answer

2-Amino-6-bromobenzoic acid
2-Amino-6-bromobenzoic acid finds applications in pharmaceuticals, particularly in the development of organic dyes and pigments for colorimetric sensors. It is also used in the synthesis of certain azo dyes and as an intermediate in the production of various polymers and semiconductor materials.

About

CAS No 20776-48-1
English Name 2-Amino-6-bromobenzoic acid
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES C1=CC(=C(C(=C1)Br)C(=O)O)N
InChIKey BNQPROAXWQCNKO-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

2-Amino-6-bromobenzoic acid is a crystalline solid with a molecular weight of approximately 267.02 g...

Compound Q&A

How is 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1) typically synthesized?

2-Amino-6-bromobenzoic acid can be synthesized via bromination of 2-aminobenzoic acid followed by pu...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

When handling 2-Amino-6-bromobenzoic acid, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...