Compound Q&A

What are the physical and chemical properties of 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

Answer

2-Amino-6-bromobenzoic acid
2-Amino-6-bromobenzoic acid is a crystalline solid with a molecular weight of approximately 267.02 g/mol. It has a low solubility in water (0.1 g/100 mL at 20°C) and exhibits typical reactivity of carboxylic acids and amines. It is moderately acidic and can undergo substitution reactions in the presence of amines and nucleophiles.

About

CAS No 20776-48-1
English Name 2-Amino-6-bromobenzoic acid
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES C1=CC(=C(C(=C1)Br)C(=O)O)N
InChIKey BNQPROAXWQCNKO-UHFFFAOYSA-N
Last Updated: 2025-09-25 13:48

Related Q&A

Compound Q&A

How is 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1) typically synthesized?

2-Amino-6-bromobenzoic acid can be synthesized via bromination of 2-aminobenzoic acid followed by pu...

Compound Q&A

What industries use 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

2-Amino-6-bromobenzoic acid finds applications in pharmaceuticals, particularly in the development o...

Compound Q&A

What precautions should be taken when handling 2-Amino-6-bromobenzoic acid (CAS: 20776-48-1)?

When handling 2-Amino-6-bromobenzoic acid, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...