Compound Q&A

How should Azasetron HCl (CAS: 123040-16-4) be stored?

Answer

Azasetron HCl
Azasetron HCl (CAS: 123040-16-4) should be stored at room temperature between 15-30°C (59-86°F). Keep the container tightly closed to protect it from moisture and light. Store it out of reach of children and pets. Do not freeze or expose to high temperatures. Use appropriate containers to prevent degradation and ensure the safety and efficacy of the product.

About

English Name Azasetron HCl
Molecular Formula C17H21Cl2N3O3
Molecular Weight 386.28 g/mol
SMILES CN1C(=O)COC2=C(C=C(C=C21)Cl)C(=O)NC3CN4CCC3CC4.Cl
InChIKey DBMKBKPJYAHLQP-UHFFFAOYSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is Azasetron HCl (CAS: 123040-16-4)?

Azasetron HCl is a selective 5-hydroxytryptamine 3 (5-HT3) receptor antagonist with antiemetic prope...

Compound Q&A

What are the main uses of Azasetron HCl (CAS: 123040-16-4)?

Azasetron HCl (CAS: 123040-16-4) is primarily used as a therapeutic agent to prevent and treat chemo...

Compound Q&A

Is Azasetron HCl (CAS: 123040-16-4) safe?

Azasetron HCl (CAS: 123040-16-4) is generally considered safe when used as directed. However, it may...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...