Compound Q&A

What are the main uses of Azasetron HCl (CAS: 123040-16-4)?

Answer

Azasetron HCl
Azasetron HCl (CAS: 123040-16-4) is primarily used as a therapeutic agent to prevent and treat chemotherapy-induced nausea and vomiting. It is also studied for its potential in managing other forms of nausea and vomiting, such as those associated with radiation therapy and post-surgical conditions.

About

English Name Azasetron HCl
Molecular Formula C17H21Cl2N3O3
Molecular Weight 386.28 g/mol
SMILES CN1C(=O)COC2=C(C=C(C=C21)Cl)C(=O)NC3CN4CCC3CC4.Cl
InChIKey DBMKBKPJYAHLQP-UHFFFAOYSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is Azasetron HCl (CAS: 123040-16-4)?

Azasetron HCl is a selective 5-hydroxytryptamine 3 (5-HT3) receptor antagonist with antiemetic prope...

Compound Q&A

Is Azasetron HCl (CAS: 123040-16-4) safe?

Azasetron HCl (CAS: 123040-16-4) is generally considered safe when used as directed. However, it may...

Compound Q&A

How should Azasetron HCl (CAS: 123040-16-4) be stored?

Azasetron HCl (CAS: 123040-16-4) should be stored at room temperature between 15-30°C (59-86°F). Kee...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...