Compound Q&A

What industries use 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

Answer

3-nitro-1H-pyridin-2-one
3-nitro-1H-pyridin-2-one is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the production of dyes, pigments, and as a precursor in the chemical industry for the development of new materials. Additionally, it plays a role in the production of organic semiconductors and sensors.

About

CAS No 6332-56-5
English Name 3-nitro-1H-pyridin-2-one
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CNC(=O)C(=C1)[N+](=O)[O-]
InChIKey BOAFCICMVMFLIT-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

3-nitro-1H-pyridin-2-one is a white to light yellow crystalline solid. Its molecular weight is appro...

Compound Q&A

How is 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5) typically synthesized?

3-nitro-1H-pyridin-2-one can be synthesized via the nitration of 1H-pyridin-2-one. The nitration rea...

Compound Q&A

What precautions should be taken when handling 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

When handling 3-nitro-1H-pyridin-2-one, it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...