Compound Q&A

How is 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5) typically synthesized?

Answer

3-nitro-1H-pyridin-2-one
3-nitro-1H-pyridin-2-one can be synthesized via the nitration of 1H-pyridin-2-one. The nitration reaction is carried out using concentrated nitric acid and sulfuric acid as the nitrating mixture. The yield and selectivity can be optimized with careful control of reaction conditions such as temperature and stirring rate.

About

CAS No 6332-56-5
English Name 3-nitro-1H-pyridin-2-one
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CNC(=O)C(=C1)[N+](=O)[O-]
InChIKey BOAFCICMVMFLIT-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

3-nitro-1H-pyridin-2-one is a white to light yellow crystalline solid. Its molecular weight is appro...

Compound Q&A

What industries use 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

3-nitro-1H-pyridin-2-one is used in the pharmaceutical industry for the synthesis of certain drugs. ...

Compound Q&A

What precautions should be taken when handling 3-nitro-1H-pyridin-2-one (CAS: 6332-56-5)?

When handling 3-nitro-1H-pyridin-2-one, it is essential to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...