Compound Q&A

What industries use bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Answer

bis(5-oxo-L-prolinato-N1,O2)zinc
Bis(5-oxo-L-prolinato-N1,O2)zinc finds applications in the pharmaceutical industry for its potential in catalytic processes and as a chelating agent. It is also used in the production of polymers for its reactivity, and in the development of sensors and semiconductors due to its coordination chemistry properties.

About

CAS No 15454-75-8
English Name bis(5-oxo-L-prolinato-N1,O2)zinc
Molecular Formula C10H12N2O6Zn
Molecular Weight 321.6 g/mol
SMILES C1CC(=O)NC1C(=O)[O-].C1CC(=O)NC1C(=O)[O-].[Zn+2]
InChIKey OWVLYQRCCIEOPF-UHFFFAOYSA-L
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Bis(5-oxo-L-prolinato-N1,O2)zinc is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8) typically synthesized?

Bis(5-oxo-L-prolinato-N1,O2)zinc is synthesized through the reaction of zinc acetate with 5-oxo-L-pr...

Compound Q&A

What precautions should be taken when handling bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

When handling bis(5-oxo-L-prolinato-N1,O2)zinc, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...