Compound Q&A

How is bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8) typically synthesized?

Answer

bis(5-oxo-L-prolinato-N1,O2)zinc
Bis(5-oxo-L-prolinato-N1,O2)zinc is synthesized through the reaction of zinc acetate with 5-oxo-L-proline. The reaction is typically performed in a solvent such as dimethylformamide (DMF) under mild conditions. The yield is generally high, and the product can be isolated by filtration and characterized using spectroscopic techniques such as NMR and mass spectrometry.

About

CAS No 15454-75-8
English Name bis(5-oxo-L-prolinato-N1,O2)zinc
Molecular Formula C10H12N2O6Zn
Molecular Weight 321.6 g/mol
SMILES C1CC(=O)NC1C(=O)[O-].C1CC(=O)NC1C(=O)[O-].[Zn+2]
InChIKey OWVLYQRCCIEOPF-UHFFFAOYSA-L
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Bis(5-oxo-L-prolinato-N1,O2)zinc is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Bis(5-oxo-L-prolinato-N1,O2)zinc finds applications in the pharmaceutical industry for its potential...

Compound Q&A

What precautions should be taken when handling bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

When handling bis(5-oxo-L-prolinato-N1,O2)zinc, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...