Compound Q&A

What are the physical and chemical properties of bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Answer

bis(5-oxo-L-prolinato-N1,O2)zinc
Bis(5-oxo-L-prolinato-N1,O2)zinc is a crystalline compound with a molecular weight of approximately 438.39 g/mol. It has a low solubility in water but is soluble in organic solvents. The compound is moderately reactive, particularly in the presence of other metal ions. It exhibits coordination chemistry typical of zinc complexes, showing stability in certain pH ranges and environments.

About

CAS No 15454-75-8
English Name bis(5-oxo-L-prolinato-N1,O2)zinc
Molecular Formula C10H12N2O6Zn
Molecular Weight 321.6 g/mol
SMILES C1CC(=O)NC1C(=O)[O-].C1CC(=O)NC1C(=O)[O-].[Zn+2]
InChIKey OWVLYQRCCIEOPF-UHFFFAOYSA-L
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8) typically synthesized?

Bis(5-oxo-L-prolinato-N1,O2)zinc is synthesized through the reaction of zinc acetate with 5-oxo-L-pr...

Compound Q&A

What industries use bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

Bis(5-oxo-L-prolinato-N1,O2)zinc finds applications in the pharmaceutical industry for its potential...

Compound Q&A

What precautions should be taken when handling bis(5-oxo-L-prolinato-N1,O2)zinc (CAS: 15454-75-8)?

When handling bis(5-oxo-L-prolinato-N1,O2)zinc, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...