Compound Q&A

What industries use Arteether (CAS: 75887-54-6)?

Answer

Arteether
Arteether (CAS: 75887-54-6) is primarily used in the pharmaceutical industry, particularly in the treatment of malaria. It is also explored in research for its potential applications in other areas such as antiviral and anti-inflammatory treatments. Additionally, its unique properties make it an interesting candidate for certain industrial processes, though it is not widely used in other sectors like polymers or semiconductors.

About

CAS No 75887-54-6
English Name Arteether
Molecular Formula C17H28O5
Molecular Weight 312.41 g/mol
SMILES CCO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3
InChIKey NLYNIRQVMRLPIQ-XQLAAWPRSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Arteether (CAS: 75887-54-6)?

Arteether (CAS: 75887-54-6) is a white, crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Arteether (CAS: 75887-54-6) typically synthesized?

Arteether (CAS: 75887-54-6) is typically synthesized via a semi-synthetic route from artesunate, wit...

Compound Q&A

What precautions should be taken when handling Arteether (CAS: 75887-54-6)?

When handling Arteether (CAS: 75887-54-6), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...