Compound Q&A

How is Arteether (CAS: 75887-54-6) typically synthesized?

Answer

Arteether
Arteether (CAS: 75887-54-6) is typically synthesized via a semi-synthetic route from artesunate, with key steps involving stereoselective C-3 demethylation and subsequent ring opening. The synthesis often employs catalytic hydrogenation and protection-deprotection strategies to achieve high yields. Common catalysts include palladium-based complexes.

About

CAS No 75887-54-6
English Name Arteether
Molecular Formula C17H28O5
Molecular Weight 312.41 g/mol
SMILES CCO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3
InChIKey NLYNIRQVMRLPIQ-XQLAAWPRSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Arteether (CAS: 75887-54-6)?

Arteether (CAS: 75887-54-6) is a white, crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use Arteether (CAS: 75887-54-6)?

Arteether (CAS: 75887-54-6) is primarily used in the pharmaceutical industry, particularly in the tr...

Compound Q&A

What precautions should be taken when handling Arteether (CAS: 75887-54-6)?

When handling Arteether (CAS: 75887-54-6), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...