Compound Q&A

What are the physical and chemical properties of Arteether (CAS: 75887-54-6)?

Answer

Arteether
Arteether (CAS: 75887-54-6) is a white, crystalline compound with a molecular weight of approximately 372.42 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and chloroform. Arteether is highly reactive, particularly towards nucleophilic substitution reactions, and it exhibits good stability under normal storage conditions but should be protected from strong oxidants.

About

CAS No 75887-54-6
English Name Arteether
Molecular Formula C17H28O5
Molecular Weight 312.41 g/mol
SMILES CCO[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3
InChIKey NLYNIRQVMRLPIQ-XQLAAWPRSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Arteether (CAS: 75887-54-6) typically synthesized?

Arteether (CAS: 75887-54-6) is typically synthesized via a semi-synthetic route from artesunate, wit...

Compound Q&A

What industries use Arteether (CAS: 75887-54-6)?

Arteether (CAS: 75887-54-6) is primarily used in the pharmaceutical industry, particularly in the tr...

Compound Q&A

What precautions should be taken when handling Arteether (CAS: 75887-54-6)?

When handling Arteether (CAS: 75887-54-6), it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...