Compound Q&A

What precautions should be taken when handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

Answer

2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
When handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride, it is essential to wear appropriate personal protective equipment (PPE) such as safety glasses, gloves, and a lab coat. Use a fume hood to minimize exposure to fumes. Store it in a cool, dry place away from direct sunlight. In case of a spill, neutralize with a base solution and dispose of according to hazardous waste regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

CAS No 68278-23-9
English Name 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
Molecular Formula C6H13ClF2N2O2
Molecular Weight 218.63 g/mol
SMILES C(CC(C(F)F)(C(=O)O)N)CN.Cl
InChIKey VKDGNNYJFSHYKD-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is a white crystalline solid with a molec...

Compound Q&A

How is 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9) typically synthesized?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is typically synthesized through a multi-...

Compound Q&A

What industries use 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is used in the pharmaceutical industry fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...