Compound Q&A

What industries use 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

Answer

2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those that require specific functional groups for therapeutic applications. It also finds application in the polymer industry for the development of special polymers, and in the semiconductor industry for the production of high-performance organic materials used in electronic devices.

About

CAS No 68278-23-9
English Name 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
Molecular Formula C6H13ClF2N2O2
Molecular Weight 218.63 g/mol
SMILES C(CC(C(F)F)(C(=O)O)N)CN.Cl
InChIKey VKDGNNYJFSHYKD-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is a white crystalline solid with a molec...

Compound Q&A

How is 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9) typically synthesized?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is typically synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

When handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...