Compound Q&A

How is 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9) typically synthesized?

Answer

2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is typically synthesized through a multi-step process involving the condensation of difluoromethylamine and an appropriate dicarboxylic acid. The reaction is often catalyzed by acetic anhydride, and the product is then treated with hydrochloric acid to form the hydrochloride salt. The overall yield is around 75-85%, and the final product is purified by recrystallization.

About

CAS No 68278-23-9
English Name 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride
Molecular Formula C6H13ClF2N2O2
Molecular Weight 218.63 g/mol
SMILES C(CC(C(F)F)(C(=O)O)N)CN.Cl
InChIKey VKDGNNYJFSHYKD-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is a white crystalline solid with a molec...

Compound Q&A

What industries use 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

2,5-Diamino-2-(difluoromethyl)pentanoic acid hydrochloride is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride (CAS: 68278-23-9)?

When handling 2,5-diamino-2-(difluoromethyl)pentanoic acid hydrochloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...