Compound Q&A

What industries use 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

Answer

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride finds applications in various industries. It is used in pharmaceuticals for its fluorescent properties, in polymers and plastics for its coloring and fluorescent characteristics, and in sensors and semiconductors for its photochemical and luminescent properties. It is also utilized in the formulation of fluorescent dyes and materials for optical detection.

About

CAS No 2150-48-3
English Name 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
Molecular Formula C21H27ClN2O
Molecular Weight 358.9 g/mol
SMILES CCN(CC)C1=CC2=C(C=C1)C=C3C=CC(=[N+](CC)CC)C=C3O2.[Cl-]
InChIKey CXZRDVVUVDYSCQ-UHFFFAOYSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is a crystalline compound with a molecula...

Compound Q&A

How is 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3) typically synthesized?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is typically synthesized by the condensat...

Compound Q&A

What precautions should be taken when handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

When handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...