Compound Q&A

How is 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3) typically synthesized?

Answer

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is typically synthesized by the condensation of 9-diethylaminofluorene with diethylamine. This reaction is carried out in the presence of a weak base like sodium carbonate to promote the formation of the iminium ion. The yield is usually around 70-80%, and the product can be purified by recrystallization from ethanol.

About

CAS No 2150-48-3
English Name 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
Molecular Formula C21H27ClN2O
Molecular Weight 358.9 g/mol
SMILES CCN(CC)C1=CC2=C(C=C1)C=C3C=CC(=[N+](CC)CC)C=C3O2.[Cl-]
InChIKey CXZRDVVUVDYSCQ-UHFFFAOYSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is a crystalline compound with a molecula...

Compound Q&A

What industries use 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride finds applications in various industries....

Compound Q&A

What precautions should be taken when handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

When handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...