Compound Q&A

What are the physical and chemical properties of 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

Answer

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is a crystalline compound with a molecular weight of approximately 443.6 g/mol. It has a high solubility in organic solvents like ethanol and acetone but is insoluble in water. The compound is moderately reactive, especially under basic conditions, and can form complexes with various metal ions. It is also known for its fluorescence properties, which make it useful in analytical chemistry and sensing applications.

About

CAS No 2150-48-3
English Name 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride
Molecular Formula C21H27ClN2O
Molecular Weight 358.9 g/mol
SMILES CCN(CC)C1=CC2=C(C=C1)C=C3C=CC(=[N+](CC)CC)C=C3O2.[Cl-]
InChIKey CXZRDVVUVDYSCQ-UHFFFAOYSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3) typically synthesized?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride is typically synthesized by the condensat...

Compound Q&A

What industries use 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride finds applications in various industries....

Compound Q&A

What precautions should be taken when handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride (CAS: 2150-48-3)?

When handling 6-(Diethylamino)-N,N-diethyl-3H-xanthen-3-iminium chloride, it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...