Compound Q&A

What industries use Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

Answer

Pralmorelin Diacetate Salt
Pralmorelin Diacetate Salt is primarily used in the pharmaceutical industry. It is a key intermediate in the synthesis of pralmorelin, a growth hormone-releasing hormone analogue used for research purposes. It may also have applications in the development of new drugs for growth hormone-related disorders.

About

English Name Pralmorelin Diacetate Salt
Molecular Formula C45H55N9O6
Molecular Weight 818 g/mol
SMILES CC(C(=O)NC(CC1=CC2=CC=CC=C2C=C1)C(=O)NC(C)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CC5=CC=CC=C5)C(=O)NC(CCCCN)C(=O)N)N
InChIKey HRNLPPBUBKMZMT-RDRUQFPZSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

Pralmorelin Diacetate Salt is a white crystalline powder. The molecular weight is approximately 534....

Compound Q&A

How is Pralmorelin Diacetate Salt (CAS: 158861-67-7) typically synthesized?

Pralmorelin Diacetate Salt can be synthesized by acetylation of pralmorelin in the presence of aceti...

Compound Q&A

What precautions should be taken when handling Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

When handling Pralmorelin Diacetate Salt, use appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...