Compound Q&A

How is Pralmorelin Diacetate Salt (CAS: 158861-67-7) typically synthesized?

Answer

Pralmorelin Diacetate Salt
Pralmorelin Diacetate Salt can be synthesized by acetylation of pralmorelin in the presence of acetic anhydride and an appropriate catalyst like pyridine. The reaction typically proceeds with a yield of around 90%. The product is isolated by crystallization from an organic solvent followed by recrystallization to improve purity.

About

English Name Pralmorelin Diacetate Salt
Molecular Formula C45H55N9O6
Molecular Weight 818 g/mol
SMILES CC(C(=O)NC(CC1=CC2=CC=CC=C2C=C1)C(=O)NC(C)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(CC5=CC=CC=C5)C(=O)NC(CCCCN)C(=O)N)N
InChIKey HRNLPPBUBKMZMT-RDRUQFPZSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

Pralmorelin Diacetate Salt is a white crystalline powder. The molecular weight is approximately 534....

Compound Q&A

What industries use Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

Pralmorelin Diacetate Salt is primarily used in the pharmaceutical industry. It is a key intermediat...

Compound Q&A

What precautions should be taken when handling Pralmorelin Diacetate Salt (CAS: 158861-67-7)?

When handling Pralmorelin Diacetate Salt, use appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...