Compound Q&A

What precautions should be taken when handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

Answer

3-(3-chlorophenyl)propanoic acid
When handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2), it is essential to use proper personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to airborne particles. In case of spills, they should be cleaned up using appropriate absorbent materials and rinsed with water. Always refer to the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

CAS No 21640-48-2
English Name 3-(3-chlorophenyl)propanoic acid
Molecular Formula C9H9ClO2
Molecular Weight 184.62 g/mol
SMILES C1=CC(=CC(=C1)Cl)CCC(=O)O
InChIKey CLTDVBQNUHHYCA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) is a white to off-white crystalline solid with a ...

Compound Q&A

How is 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) typically synthesized?

3-(3-chlorophenyl)propanoic acid is typically synthesized through the reaction of 3-chlorophenyl pro...

Compound Q&A

What industries use 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

3-(3-chlorophenyl)propanoic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...