Compound Q&A

What industries use 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

Answer

3-(3-chlorophenyl)propanoic acid
3-(3-chlorophenyl)propanoic acid is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also utilized as a precursor in the polymer industry for the production of certain types of polymers. Additionally, it is employed in the sensor industry due to its chemical reactivity and in some semiconductor applications for specific functional groups.

About

CAS No 21640-48-2
English Name 3-(3-chlorophenyl)propanoic acid
Molecular Formula C9H9ClO2
Molecular Weight 184.62 g/mol
SMILES C1=CC(=CC(=C1)Cl)CCC(=O)O
InChIKey CLTDVBQNUHHYCA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) is a white to off-white crystalline solid with a ...

Compound Q&A

How is 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) typically synthesized?

3-(3-chlorophenyl)propanoic acid is typically synthesized through the reaction of 3-chlorophenyl pro...

Compound Q&A

What precautions should be taken when handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

When handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2), it is essential to use proper pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...