Compound Q&A

What are the physical and chemical properties of 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

Answer

3-(3-chlorophenyl)propanoic acid
3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) is a white to off-white crystalline solid with a molecular weight of 228.63 g/mol. It has a high melting point of 165-167°C and is slightly soluble in water. The compound is reactive towards strong bases and is susceptible to hydrolysis under basic conditions. It is used in the synthesis of pharmaceuticals and as a precursor in organic chemistry.

About

CAS No 21640-48-2
English Name 3-(3-chlorophenyl)propanoic acid
Molecular Formula C9H9ClO2
Molecular Weight 184.62 g/mol
SMILES C1=CC(=CC(=C1)Cl)CCC(=O)O
InChIKey CLTDVBQNUHHYCA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2) typically synthesized?

3-(3-chlorophenyl)propanoic acid is typically synthesized through the reaction of 3-chlorophenyl pro...

Compound Q&A

What industries use 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

3-(3-chlorophenyl)propanoic acid is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2)?

When handling 3-(3-chlorophenyl)propanoic acid (CAS: 21640-48-2), it is essential to use proper pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...