Compound Q&A

What industries use (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

Answer

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (non-preferred name)
(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid is used in various industries. It is extensively used in the pharmaceutical sector for the synthesis of biologically active compounds, particularly in the development of peptides and proteins. In the polymer industry, it is employed as a cross-linking agent to improve the mechanical properties of polymers. Additionally, it has applications in the semiconductor industry for producing high-quality materials and in the field of sensors for detecting specific chemical analytes.

About

CAS No 20846-91-7
English Name (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (non-preferred name)
Molecular Formula C10H16N2O8
Molecular Weight 292.24 g/mol
SMILES O=C(O)[C@@H](NCCN[C@@H](CC(O)=O)C(O)=O)CC(O)=O
InChIKey VKZRWSNIWNFCIQ-WDSKDSINSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid is a white, crystalline solid with a molecular ...

Compound Q&A

How is (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7) typically synthesized?

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid can be synthesized through the condensation of ...

Compound Q&A

What precautions should be taken when handling (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

When handling (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...