Compound Q&A

What are the physical and chemical properties of (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

Answer

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (non-preferred name)
(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid is a white, crystalline solid with a molecular weight of approximately 446.34 g/mol. It is slightly soluble in water and more soluble in organic solvents. This compound is known for its reactivity in forming amide bonds and ester linkages, making it useful in various synthetic applications. Its pKa values are around 3.7 and 4.6, indicating its acidity in aqueous solutions.

About

CAS No 20846-91-7
English Name (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (non-preferred name)
Molecular Formula C10H16N2O8
Molecular Weight 292.24 g/mol
SMILES O=C(O)[C@@H](NCCN[C@@H](CC(O)=O)C(O)=O)CC(O)=O
InChIKey VKZRWSNIWNFCIQ-WDSKDSINSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7) typically synthesized?

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid can be synthesized through the condensation of ...

Compound Q&A

What industries use (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

(2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid is used in various industries. It is extensivel...

Compound Q&A

What precautions should be taken when handling (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid (CAS: 20846-91-7)?

When handling (2S,2'S)-2,2'-(1,2-Ethanediyldiimino)disuccinic acid, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...