Compound Q&A

What precautions should be taken when handling Atazanavir Impurity 20 (CAS: 102123-74-0)?

Answer

Atazanavir Impurity 20
When handling Atazanavir Impurity 20 (CAS: 102123-74-0), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area, preferably in a fume hood, to minimize inhalation risks. In case of spillage, the area should be thoroughly cleaned with appropriate solvents, and the spill documentation should be recorded following safety protocols. Always refer to the Safety Data Sheet (SDS) for detailed instructions.

About

English Name Atazanavir Impurity 20
Molecular Formula C15H20ClNO3
Molecular Weight 297.78 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)CCl
InChIKey JAKDNFBATYIEIE-LBPRGKRZSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atazanavir Impurity 20 (CAS: 102123-74-0)?

Atazanavir Impurity 20 (CAS: 102123-74-0) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Atazanavir Impurity 20 (CAS: 102123-74-0) typically synthesized?

Atazanavir Impurity 20 (CAS: 102123-74-0) is typically synthesized using a multistep process involvi...

Compound Q&A

What industries use Atazanavir Impurity 20 (CAS: 102123-74-0)?

Atazanavir Impurity 20 (CAS: 102123-74-0) is primarily used in the pharmaceutical industry as an imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...