Compound Q&A

What are the physical and chemical properties of Atazanavir Impurity 20 (CAS: 102123-74-0)?

Answer

Atazanavir Impurity 20
Atazanavir Impurity 20 (CAS: 102123-74-0) is a crystalline compound with a molecular weight of approximately 652.72 g/mol. It is poorly water-soluble, with a solubility of about 1 mg/L. This impurity is relatively stable under normal conditions but may react with strong acids or bases. It is important to handle it under appropriate storage conditions to maintain its stability.

About

English Name Atazanavir Impurity 20
Molecular Formula C15H20ClNO3
Molecular Weight 297.78 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)CCl
InChIKey JAKDNFBATYIEIE-LBPRGKRZSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Atazanavir Impurity 20 (CAS: 102123-74-0) typically synthesized?

Atazanavir Impurity 20 (CAS: 102123-74-0) is typically synthesized using a multistep process involvi...

Compound Q&A

What industries use Atazanavir Impurity 20 (CAS: 102123-74-0)?

Atazanavir Impurity 20 (CAS: 102123-74-0) is primarily used in the pharmaceutical industry as an imp...

Compound Q&A

What precautions should be taken when handling Atazanavir Impurity 20 (CAS: 102123-74-0)?

When handling Atazanavir Impurity 20 (CAS: 102123-74-0), it is crucial to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...