Compound Q&A

What industries use Atazanavir Impurity 20 (CAS: 102123-74-0)?

Answer

Atazanavir Impurity 20
Atazanavir Impurity 20 (CAS: 102123-74-0) is primarily used in the pharmaceutical industry as an impurity in the synthesis and production of Atazanavir, a widely used antiretroviral drug. While it has limited direct applications, it plays a crucial role in ensuring the purity of Atazanavir products, making it essential for the pharmaceutical sector.

About

English Name Atazanavir Impurity 20
Molecular Formula C15H20ClNO3
Molecular Weight 297.78 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)CCl
InChIKey JAKDNFBATYIEIE-LBPRGKRZSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atazanavir Impurity 20 (CAS: 102123-74-0)?

Atazanavir Impurity 20 (CAS: 102123-74-0) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Atazanavir Impurity 20 (CAS: 102123-74-0) typically synthesized?

Atazanavir Impurity 20 (CAS: 102123-74-0) is typically synthesized using a multistep process involvi...

Compound Q&A

What precautions should be taken when handling Atazanavir Impurity 20 (CAS: 102123-74-0)?

When handling Atazanavir Impurity 20 (CAS: 102123-74-0), it is crucial to use appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...