Compound Q&A

What industries use Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Answer

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also utilized in the semiconductor and electronics industry for the production of photoresists and other functional materials. Additionally, it is employed in the polymer industry as a precursor for the synthesis of various polymer additives and surface coatings.

About

CAS No 74073-22-6
English Name Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Molecular Formula C12H10Cl2O3
Molecular Weight 273.11 g/mol
SMILES CC(=O)C(=CC1=C(C(=CC=C1)Cl)Cl)C(=O)OC
InChIKey QQXPSPWWWCQBFM-RMKNXTFCSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is a crystalline compound with a mo...

Compound Q&A

How is Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) typically synthesized?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is typically synthesized via a cond...

Compound Q&A

What precautions should be taken when handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

When handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...