Compound Q&A

What are the physical and chemical properties of Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Answer

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is a crystalline compound with a molecular weight of approximately 334.02 g/mol. It has a low water solubility, with a maximum solubility of 0.1 g/L at 20°C. The compound is highly reactive due to its chlorinated benzylidene group, making it susceptible to degradation under basic conditions. It is insoluble in water but soluble in organic solvents such as acetone and dichloromethane.

About

CAS No 74073-22-6
English Name Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Molecular Formula C12H10Cl2O3
Molecular Weight 273.11 g/mol
SMILES CC(=O)C(=CC1=C(C(=CC=C1)Cl)Cl)C(=O)OC
InChIKey QQXPSPWWWCQBFM-RMKNXTFCSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) typically synthesized?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is typically synthesized via a cond...

Compound Q&A

What industries use Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

When handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...