Compound Q&A

How is Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) typically synthesized?

Answer

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is typically synthesized via a condensation reaction of 2,3-dichlorobenzaldehyde and acetoacetic ester. This reaction is often catalyzed by a Lewis acid such as aluminum trichloride in anhydrous conditions to achieve high yield and selectivity. The process involves careful control of temperature and reaction time to ensure optimal product formation.

About

CAS No 74073-22-6
English Name Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate
Molecular Formula C12H10Cl2O3
Molecular Weight 273.11 g/mol
SMILES CC(=O)C(=CC1=C(C(=CC=C1)Cl)Cl)C(=O)OC
InChIKey QQXPSPWWWCQBFM-RMKNXTFCSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is a crystalline compound with a mo...

Compound Q&A

What industries use Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6) is used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6)?

When handling Methyl 2-(2,3-Dichlorobenzylidene)acetoacetate (CAS: 74073-22-6), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...