Compound Q&A

How is (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9) typically synthesized?

Answer

2-Methyl-2-propanyl [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenyl-2-hexanyl]carbamate
This compound is typically synthesized via a multi-step process involving the condensation of an amino alcohol with an acid chloride, followed by deprotection and diphenylation. Common catalysts include DCC (dicyclohexylcarbodiimide) and EDC (N,N′-carbonyldiimidazole). The yield is generally around 70-80%, and the reaction is carried out under anhydrous conditions to avoid side reactions.

About

English Name 2-Methyl-2-propanyl [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenyl-2-hexanyl]carbamate
Molecular Formula C23H32N2O3
Molecular Weight 384.52 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CC(C(CC2=CC=CC=C2)N)O
InChIKey UKFHOTNATOJBKZ-ACRUOGEOSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

The compound (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate has a crystalline form and...

Compound Q&A

What industries use (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

When handling (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate, it is crucial to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...