Compound Q&A

What are the physical and chemical properties of (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

Answer

2-Methyl-2-propanyl [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenyl-2-hexanyl]carbamate
The compound (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate has a crystalline form and a molecular weight of approximately 361.34 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. The compound exhibits moderate reactivity, particularly towards nucleophiles such as amines and hydroxides. It is stable under normal conditions but should be handled in a fume hood to avoid inhalation.

About

English Name 2-Methyl-2-propanyl [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenyl-2-hexanyl]carbamate
Molecular Formula C23H32N2O3
Molecular Weight 384.52 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)CC(C(CC2=CC=CC=C2)N)O
InChIKey UKFHOTNATOJBKZ-ACRUOGEOSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9) typically synthesized?

This compound is typically synthesized via a multi-step process involving the condensation of an ami...

Compound Q&A

What industries use (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

This compound is used in the pharmaceutical industry for its potential as a precursor in drug synthe...

Compound Q&A

What precautions should be taken when handling (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate (CAS: 144163-85-9)?

When handling (2S,4S,5S)-5-Amino-4-hydroxy-1,6-diphenyl-2-hexanylcarbamate, it is crucial to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...