Compound Q&A

What precautions should be taken when handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

Answer

(3,5-Di-tert-butylphenyl)boronic acid
When handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5), it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. This compound should be stored in a fume hood and handled in a well-ventilated area. Spills should be cleaned up immediately with appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name (3,5-Di-tert-butylphenyl)boronic acid
Molecular Formula C14H23BO2
Molecular Weight 234.15 g/mol
SMILES B(C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O
InChIKey RPCBIEHUQSGPNA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is a solid, crystalline compound with a mol...

Compound Q&A

How is (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) typically synthesized?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) can be synthesized by the boronation of 3,5...

Compound Q&A

What industries use (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is widely used in the pharmaceutical indust...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...