Compound Q&A

What industries use (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

Answer

(3,5-Di-tert-butylphenyl)boronic acid
(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is widely used in the pharmaceutical industry for the synthesis of various organic compounds. It is also utilized in the polymer industry for the modification of polymer properties. Additionally, it finds applications in sensor technology and semiconductor manufacturing due to its reactivity and stability.

About

English Name (3,5-Di-tert-butylphenyl)boronic acid
Molecular Formula C14H23BO2
Molecular Weight 234.15 g/mol
SMILES B(C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O
InChIKey RPCBIEHUQSGPNA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is a solid, crystalline compound with a mol...

Compound Q&A

How is (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) typically synthesized?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) can be synthesized by the boronation of 3,5...

Compound Q&A

What precautions should be taken when handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

When handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5), it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...