Compound Q&A

What are the physical and chemical properties of (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

Answer

(3,5-Di-tert-butylphenyl)boronic acid
(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is a solid, crystalline compound with a molecular weight of approximately 310.39 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and dichloromethane. This compound is known for its moderate reactivity, particularly in organoboron reactions and its ability to participate in catalytic processes.

About

English Name (3,5-Di-tert-butylphenyl)boronic acid
Molecular Formula C14H23BO2
Molecular Weight 234.15 g/mol
SMILES B(C1=CC(=CC(=C1)C(C)(C)C)C(C)(C)C)(O)O
InChIKey RPCBIEHUQSGPNA-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) typically synthesized?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) can be synthesized by the boronation of 3,5...

Compound Q&A

What industries use (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

(3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5) is widely used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5)?

When handling (3,5-Di-tert-butylphenyl)boronic acid (CAS: 197223-39-5), it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...