Compound Q&A

How is Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) typically synthesized?

Answer

Candesartan Cilexetil Impurity 9
Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is synthesized via a multistep process involving acylation, cyclization, and esterification reactions. Common catalysts used include sulfonyl chlorides and carboxylic acids. The synthesis typically achieves a yield of around 75%, with high selectivity towards the desired impurity. Detailed synthetic routes and purification methods can be found in chemical literature.

About

English Name Candesartan Cilexetil Impurity 9
Molecular Formula C23H19N3O4
Molecular Weight 401.4 g/mol
SMILES CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])NCC2=CC=C(C=C2)C3=CC=CC=C3C#N
InChIKey CHPMKOFPDCKNBG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is a white to off-white crystalline powder. Its ...

Compound Q&A

What industries use Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

When handling Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...