Compound Q&A

What are the physical and chemical properties of Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

Answer

Candesartan Cilexetil Impurity 9
Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is a white to off-white crystalline powder. Its molecular weight is approximately 484.57 g/mol. This impurity is slightly soluble in water and ethanol. It is relatively stable under normal conditions but may react with strong acids or bases. Detailed physicochemical properties include melting point (about 110-115°C) and density (1.58 g/cm³).

About

English Name Candesartan Cilexetil Impurity 9
Molecular Formula C23H19N3O4
Molecular Weight 401.4 g/mol
SMILES CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])NCC2=CC=C(C=C2)C3=CC=CC=C3C#N
InChIKey CHPMKOFPDCKNBG-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) typically synthesized?

Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is synthesized via a multistep process involving...

Compound Q&A

What industries use Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1) is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1)?

When handling Candesartan Cilexetil Impurity 9 (CAS: 136285-67-1), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...