Compound Q&A

What industries use 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

Answer

6-Chloro-2-methyl-3-nitropyridine
6-Chloro-2-methyl-3-nitropyridine finds applications primarily in the pharmaceutical industry, where it serves as a precursor to various drug candidates. It is also used in the synthesis of certain agrochemicals and sensors due to its unique reactivity and functional groups. Its use in semiconductor and polymer industries is less common but not entirely absent.

About

CAS No 56057-19-3
English Name 6-Chloro-2-methyl-3-nitropyridine
Molecular Formula C6H5ClN2O2
Molecular Weight 172.57 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])Cl
InChIKey GHSRMSJVYMITDX-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

6-Chloro-2-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 19...

Compound Q&A

How is 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3) typically synthesized?

6-Chloro-2-methyl-3-nitropyridine is commonly synthesized through electrophilic aromatic substitutio...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

When handling 6-Chloro-2-methyl-3-nitropyridine, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...