Compound Q&A

What are the physical and chemical properties of 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

Answer

6-Chloro-2-methyl-3-nitropyridine
6-Chloro-2-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 199.01 g/mol. Its solubility in water is low, typically less than 1 g/L at 25°C. It is moderately reactive, particularly towards reducing agents and bases. The compound is highly soluble in organic solvents like dichloromethane and acetonitrile.

About

CAS No 56057-19-3
English Name 6-Chloro-2-methyl-3-nitropyridine
Molecular Formula C6H5ClN2O2
Molecular Weight 172.57 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])Cl
InChIKey GHSRMSJVYMITDX-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3) typically synthesized?

6-Chloro-2-methyl-3-nitropyridine is commonly synthesized through electrophilic aromatic substitutio...

Compound Q&A

What industries use 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

6-Chloro-2-methyl-3-nitropyridine finds applications primarily in the pharmaceutical industry, where...

Compound Q&A

What precautions should be taken when handling 6-Chloro-2-methyl-3-nitropyridine (CAS: 56057-19-3)?

When handling 6-Chloro-2-methyl-3-nitropyridine, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...