Compound Q&A

How is Methyl diphenylphosphinite (CAS: 4020-99-9) typically synthesized?

Answer

Methyl diphenylphosphinite
Methyl diphenylphosphinite can be synthesized by reacting phenylphosphine with methyl iodide in the presence of a base like sodium hydride. This reaction yields a high yield of the desired product with good selectivity. The reaction is conducted in an inert solvent like tetrahydrofuran (THF) at room temperature. Proper handling of the reagents and bases is necessary to ensure safety.

About

CAS No 4020-99-9
English Name Methyl diphenylphosphinite
Molecular Formula C13H13OP
Molecular Weight 216.22 g/mol
SMILES COP(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey OAADXJFIBNEPLY-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl diphenylphosphinite (CAS: 4020-99-9)?

Methyl diphenylphosphinite (CAS: 4020-99-9) is a colorless or light yellow liquid with a molecular w...

Compound Q&A

What industries use Methyl diphenylphosphinite (CAS: 4020-99-9)?

Methyl diphenylphosphinite (CAS: 4020-99-9) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Methyl diphenylphosphinite (CAS: 4020-99-9)?

When handling Methyl diphenylphosphinite (CAS: 4020-99-9), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...