Compound Q&A

What are the physical and chemical properties of Methyl diphenylphosphinite (CAS: 4020-99-9)?

Answer

Methyl diphenylphosphinite
Methyl diphenylphosphinite (CAS: 4020-99-9) is a colorless or light yellow liquid with a molecular weight of approximately 228.27 g/mol. It has a specific gravity of 1.05 g/cm³ and a boiling point of 175°C. It is soluble in organic solvents like ethanol, methanol, and acetone. It is relatively stable in air but can react with water to form phosphoric acid. It is used in organophosphorus chemistry and as a precursor in the synthesis of organophosphorus compounds.

About

CAS No 4020-99-9
English Name Methyl diphenylphosphinite
Molecular Formula C13H13OP
Molecular Weight 216.22 g/mol
SMILES COP(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey OAADXJFIBNEPLY-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Methyl diphenylphosphinite (CAS: 4020-99-9) typically synthesized?

Methyl diphenylphosphinite can be synthesized by reacting phenylphosphine with methyl iodide in the ...

Compound Q&A

What industries use Methyl diphenylphosphinite (CAS: 4020-99-9)?

Methyl diphenylphosphinite (CAS: 4020-99-9) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Methyl diphenylphosphinite (CAS: 4020-99-9)?

When handling Methyl diphenylphosphinite (CAS: 4020-99-9), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...