Compound Q&A

How is Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) typically synthesized?

Answer

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate
Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is commonly synthesized via the reaction of ethyl acrylate or phenol with 3,4-dihydroxybenzaldehyde or its derivatives. The reaction typically involves a condensation followed by an acylation step, often catalyzed by acidic or basic conditions, yielding a high yield of the desired product with good selectivity.

About

CAS No 102-37-4
English Name Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES O=C(OCC)/C=C/C1=CC=C(O)C(O)=C1
InChIKey WDKYDMULARNCIS-GQCTYLIASA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is a colorless to light yellow liquid wit...

Compound Q&A

What industries use Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is utilized in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

When handling Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4), appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...