Compound Q&A

What are the physical and chemical properties of Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

Answer

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate
Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is a colorless to light yellow liquid with a molecular weight of approximately 206.18 g/mol. It has a pKa of around 2.5 and is slightly soluble in water. The compound is reactive due to the presence of the unsaturated acrylate group and phenolic hydroxyl groups, making it suitable for various chemical reactions and applications.

About

CAS No 102-37-4
English Name Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES O=C(OCC)/C=C/C1=CC=C(O)C(O)=C1
InChIKey WDKYDMULARNCIS-GQCTYLIASA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) typically synthesized?

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is commonly synthesized via the reaction ...

Compound Q&A

What industries use Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4) is utilized in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4)?

When handling Ethyl (2E)-3-(3,4-dihydroxyphenyl)acrylate (CAS: 102-37-4), appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...